C16H20IN4O4+ — CID 18929954
2-hydroxyethyl(trimethyl)azanium;7-iodo-3,5-dihydro-2H-pyridazino[4,5-b]quinoline-1,4,10-trione (PubChem CID 18929954) has the molecular formula C16H20IN4O4+ and a molecular weight of 459.26 g/mol. Its IUPAC name is 2-hydroxyethyl(trimethyl)azanium;7-iodo-3,5-dihydro-2H-pyridazino[4,5-b]quinoline-1,4,10-trione.
| Compound Name | 2-hydroxyethyl(trimethyl)azanium;7-iodo-3,5-dihydro-2H-pyridazino[4,5-b]quinoline-1,4,10-trione |
|---|---|
| PubChem CID | 18929954 |
| Molecular Formula | C16H20IN4O4+ |
| Molecular Weight | 459.26 g/mol |
| Exact Mass | 459.05 |
| IUPAC Name | 2-hydroxyethyl(trimethyl)azanium;7-iodo-3,5-dihydro-2H-pyridazino[4,5-b]quinoline-1,4,10-trione |
| SMILES | C[N+](C)(C)CCO.O=c1[nH][nH]c(=O)c2c(=O)c3ccc(I)cc3[nH]c12 |
| InChI | InChI=1S/C11H6IN3O3.C5H14NO/c12-4-1-2-5-6(3-4)13-8-7(9(5)16)10(17)14-15-11(8)18;1-6(2,3)4-5-7/h1-3H,(H,13,16)(H,14,17)(H,15,18);7H,4-5H2,1-3H3/q;+1 |
| InChIKey | OEMNWFPLBGBDLW-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 118.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.26 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|