C11H5Cl2N3O3 — CID 18929959
7,9-dichloro-3,5-dihydro-2H-pyridazino[4,5-b]quinoline-1,4,10-trione (PubChem CID 18929959) has the molecular formula C11H5Cl2N3O3 and a molecular weight of 298.09 g/mol. Its IUPAC name is 7,9-dichloro-3,5-dihydro-2H-pyridazino[4,5-b]quinoline-1,4,10-trione.
| Compound Name | 7,9-dichloro-3,5-dihydro-2H-pyridazino[4,5-b]quinoline-1,4,10-trione |
|---|---|
| PubChem CID | 18929959 |
| Molecular Formula | C11H5Cl2N3O3 |
| Molecular Weight | 298.09 g/mol |
| Exact Mass | 296.97 |
| IUPAC Name | 7,9-dichloro-3,5-dihydro-2H-pyridazino[4,5-b]quinoline-1,4,10-trione |
| SMILES | O=c1[nH][nH]c(=O)c2c(=O)c3c(Cl)cc(Cl)cc3[nH]c12 |
| InChI | InChI=1S/C11H5Cl2N3O3/c12-3-1-4(13)6-5(2-3)14-8-7(9(6)17)10(18)15-16-11(8)19/h1-2H,(H,14,17)(H,15,18)(H,16,19) |
| InChIKey | ZHKXUMGWWSETDH-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.09 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|