About 7-[2-(4,4-difluoro-6-methyl-3-oxooctyl)-3-hydroxy-5-oxocyclopentyl]heptanoic acid
7-[2-(4,4-difluoro-6-methyl-3-oxooctyl)-3-hydroxy-5-oxocyclopentyl]heptanoic acid (PubChem CID 18930485) has the molecular formula C21H34F2O5
and a molecular weight of 404.49 g/mol. Its IUPAC name is 7-[2-(4,4-difluoro-6-methyl-3-oxooctyl)-3-hydroxy-5-oxocyclopentyl]heptanoic acid.
Molecular Properties
| Compound Name | 7-[2-(4,4-difluoro-6-methyl-3-oxooctyl)-3-hydroxy-5-oxocyclopentyl]heptanoic acid |
| PubChem CID | 18930485 |
| Molecular Formula | C21H34F2O5 |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | 7-[2-(4,4-difluoro-6-methyl-3-oxooctyl)-3-hydroxy-5-oxocyclopentyl]heptanoic acid |
| SMILES | CCC(C)CC(F)(F)C(=O)CCC1C(O)CC(=O)C1CCCCCCC(=O)O |
| InChI | InChI=1S/C21H34F2O5/c1-3-14(2)13-21(22,23)19(26)11-10-16-15(17(24)12-18(16)25)8-6-4-5-7-9-20(27)28/h14-16,18,25H,3-13H2,1-2H3,(H,27,28) |
| InChIKey | HMVCPYRGXGTITP-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-[2-(4,4-difluoro-6-methyl-3-oxooctyl)-3-hydroxy-5-oxocyclopentyl]heptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[2-(4,4-difluoro-6-methyl-3-oxooctyl)-3-hydroxy-5-oxocyclopentyl]heptanoic acid?
The IUPAC name of 7-[2-(4,4-difluoro-6-methyl-3-oxooctyl)-3-hydroxy-5-oxocyclopentyl]heptanoic acid (CID 18930485) is 7-[2-(4,4-difluoro-6-methyl-3-oxooctyl)-3-hydroxy-5-oxocyclopentyl]heptanoic acid.
What is the SMILES notation for 7-[2-(4,4-difluoro-6-methyl-3-oxooctyl)-3-hydroxy-5-oxocyclopentyl]heptanoic acid?
The canonical SMILES for 7-[2-(4,4-difluoro-6-methyl-3-oxooctyl)-3-hydroxy-5-oxocyclopentyl]heptanoic acid is CCC(C)CC(F)(F)C(=O)CCC1C(O)CC(=O)C1CCCCCCC(=O)O.
What is the InChIKey of 7-[2-(4,4-difluoro-6-methyl-3-oxooctyl)-3-hydroxy-5-oxocyclopentyl]heptanoic acid?
The InChIKey is HMVCPYRGXGTITP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H34F2O5/c1-3-14(2)13-21(22,23)19(26)11-10-16-15(17(24)12-18(16)25)8-6-4-5-7-9-20(27)28/h14-16,18,25H,3-13H2,1-2H3,(H,27,28).
What are the key properties of 7-[2-(4,4-difluoro-6-methyl-3-oxooctyl)-3-hydroxy-5-oxocyclopentyl]heptanoic acid?
7-[2-(4,4-difluoro-6-methyl-3-oxooctyl)-3-hydroxy-5-oxocyclopentyl]heptanoic acid has a molecular weight of 404.49 g/mol, XLogP of 4.40, 14 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[2-(4,4-difluoro-6-methyl-3-oxooctyl)-3-hydroxy-5-oxocyclopentyl]heptanoic acid is sourced from PubChem (CID 18930485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).