C8H14ClN3O2 — CID 18931313
3-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione;hydrochloride (PubChem CID 18931313) has the molecular formula C8H14ClN3O2 and a molecular weight of 219.67 g/mol. Its IUPAC name is 3-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione;hydrochloride.
| Compound Name | 3-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 18931313 |
| Molecular Formula | C8H14ClN3O2 |
| Molecular Weight | 219.67 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 3-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione;hydrochloride |
| SMILES | CN1C(=O)NC2(CCNCC2)C1=O.Cl |
| InChI | InChI=1S/C8H13N3O2.ClH/c1-11-6(12)8(10-7(11)13)2-4-9-5-3-8;/h9H,2-5H2,1H3,(H,10,13);1H |
| InChIKey | SOPWZZACEHCWCT-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.67 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|