C6H5ClF6O2 — CID 18931708
2-(1-chloro-2,2,2-trifluoroethyl)-2-(trifluoromethyl)-1,3-dioxolane (PubChem CID 18931708) has the molecular formula C6H5ClF6O2 and a molecular weight of 258.54 g/mol. Its IUPAC name is 2-(1-chloro-2,2,2-trifluoroethyl)-2-(trifluoromethyl)-1,3-dioxolane.
| Compound Name | 2-(1-chloro-2,2,2-trifluoroethyl)-2-(trifluoromethyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 18931708 |
| Molecular Formula | C6H5ClF6O2 |
| Molecular Weight | 258.54 g/mol |
| Exact Mass | 257.99 |
| IUPAC Name | 2-(1-chloro-2,2,2-trifluoroethyl)-2-(trifluoromethyl)-1,3-dioxolane |
| SMILES | FC(F)(F)C(Cl)C1(C(F)(F)F)OCCO1 |
| InChI | InChI=1S/C6H5ClF6O2/c7-3(5(8,9)10)4(6(11,12)13)14-1-2-15-4/h3H,1-2H2 |
| InChIKey | BARHKLZOVFGWDR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.54 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|