C51H66O12 — CID 18931805
3-[3,6,11-tripentoxy-7,10-bis(3-prop-2-enoyloxypropoxy)triphenylen-2-yl]oxypropyl prop-2-enoate (PubChem CID 18931805) has the molecular formula C51H66O12 and a molecular weight of 871.08 g/mol. Its IUPAC name is 3-[3,6,11-tripentoxy-7,10-bis(3-prop-2-enoyloxypropoxy)triphenylen-2-yl]oxypropyl prop-2-enoate.
| Compound Name | 3-[3,6,11-tripentoxy-7,10-bis(3-prop-2-enoyloxypropoxy)triphenylen-2-yl]oxypropyl prop-2-enoate |
|---|---|
| PubChem CID | 18931805 |
| Molecular Formula | C51H66O12 |
| Molecular Weight | 871.08 g/mol |
| Exact Mass | 870.46 |
| IUPAC Name | 3-[3,6,11-tripentoxy-7,10-bis(3-prop-2-enoyloxypropoxy)triphenylen-2-yl]oxypropyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCOc1cc2c(cc1OCCCCC)c1cc(OCCCCC)c(OCCCOC(=O)C=C)cc1c1cc(OCCCOC(=O)C=C)c(OCCCCC)cc21 |
| InChI | InChI=1S/C51H66O12/c1-7-13-16-22-55-43-31-37-38-32-44(56-23-17-14-8-2)47(59-26-20-29-62-50(53)11-5)35-41(38)42-36-48(60-27-21-30-63-51(54)12-6)45(57-24-18-15-9-3)33-39(42)40(37)34-46(43)58-25-19-28-61-49(52)10-4/h10-12,31-36H,4-9,13-30H2,1-3H3 |
| InChIKey | BMVUXIQZYWYTMR-UHFFFAOYSA-N |
| XLogP | 11.35 |
| TPSA | 134.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.08 |
| LogP ≤ 5 | 11.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|