About 1,4-dibromoisoquinoline;1,4-dichloroisoquinoline
1,4-dibromoisoquinoline;1,4-dichloroisoquinoline (PubChem CID 18931878) has the molecular formula C18H10Br2Cl2N2
and a molecular weight of 485.01 g/mol. Its IUPAC name is 1,4-dibromoisoquinoline;1,4-dichloroisoquinoline.
Molecular Properties
| Compound Name | 1,4-dibromoisoquinoline;1,4-dichloroisoquinoline |
| PubChem CID | 18931878 |
| Molecular Formula | C18H10Br2Cl2N2 |
| Molecular Weight | 485.01 g/mol |
| Exact Mass | 481.86 |
| IUPAC Name | 1,4-dibromoisoquinoline;1,4-dichloroisoquinoline |
| SMILES | Brc1cnc(Br)c2ccccc12.Clc1cnc(Cl)c2ccccc12 |
| InChI | InChI=1S/C9H5Br2N.C9H5Cl2N/c2*10-8-5-12-9(11)7-4-2-1-3-6(7)8/h2*1-5H |
| InChIKey | JLGLAAWJQRRPFY-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 485.01 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dibromoisoquinoline;1,4-dichloroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dibromoisoquinoline;1,4-dichloroisoquinoline?
The IUPAC name of 1,4-dibromoisoquinoline;1,4-dichloroisoquinoline (CID 18931878) is 1,4-dibromoisoquinoline;1,4-dichloroisoquinoline.
What is the SMILES notation for 1,4-dibromoisoquinoline;1,4-dichloroisoquinoline?
The canonical SMILES for 1,4-dibromoisoquinoline;1,4-dichloroisoquinoline is Brc1cnc(Br)c2ccccc12.Clc1cnc(Cl)c2ccccc12.
What is the InChIKey of 1,4-dibromoisoquinoline;1,4-dichloroisoquinoline?
The InChIKey is JLGLAAWJQRRPFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5Br2N.C9H5Cl2N/c2*10-8-5-12-9(11)7-4-2-1-3-6(7)8/h2*1-5H.
What are the key properties of 1,4-dibromoisoquinoline;1,4-dichloroisoquinoline?
1,4-dibromoisoquinoline;1,4-dichloroisoquinoline has a molecular weight of 485.01 g/mol, XLogP of 7.30, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dibromoisoquinoline;1,4-dichloroisoquinoline is sourced from PubChem (CID 18931878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).