C16H16O3S — CID 18932662
3-propanethioyl-3,4,9,10-tetrahydro-1H-benzo[g]isochromene-5,8-dione (PubChem CID 18932662) has the molecular formula C16H16O3S and a molecular weight of 288.37 g/mol. Its IUPAC name is 3-propanethioyl-3,4,9,10-tetrahydro-1H-benzo[g]isochromene-5,8-dione.
| Compound Name | 3-propanethioyl-3,4,9,10-tetrahydro-1H-benzo[g]isochromene-5,8-dione |
|---|---|
| PubChem CID | 18932662 |
| Molecular Formula | C16H16O3S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 3-propanethioyl-3,4,9,10-tetrahydro-1H-benzo[g]isochromene-5,8-dione |
| SMILES | CCC(=S)C1CC2=C(CO1)CC1=C(C=CC(=O)C1)C2=O |
| InChI | InChI=1S/C16H16O3S/c1-2-15(20)14-7-13-10(8-19-14)5-9-6-11(17)3-4-12(9)16(13)18/h3-4,14H,2,5-8H2,1H3 |
| InChIKey | AUDAGMCATINVHG-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|