About 4-(6-chloro-2,3-dihydroindol-1-yl)-6,7-dimethylquinazoline
4-(6-chloro-2,3-dihydroindol-1-yl)-6,7-dimethylquinazoline (PubChem CID 18932855) has the molecular formula C18H16ClN3
and a molecular weight of 309.80 g/mol. Its IUPAC name is 4-(6-chloro-2,3-dihydroindol-1-yl)-6,7-dimethylquinazoline.
Molecular Properties
| Compound Name | 4-(6-chloro-2,3-dihydroindol-1-yl)-6,7-dimethylquinazoline |
| PubChem CID | 18932855 |
| Molecular Formula | C18H16ClN3 |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 4-(6-chloro-2,3-dihydroindol-1-yl)-6,7-dimethylquinazoline |
| SMILES | Cc1cc2ncnc(N3CCc4ccc(Cl)cc43)c2cc1C |
| InChI | InChI=1S/C18H16ClN3/c1-11-7-15-16(8-12(11)2)20-10-21-18(15)22-6-5-13-3-4-14(19)9-17(13)22/h3-4,7-10H,5-6H2,1-2H3 |
| InChIKey | DLOGGEPZOLRYJP-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(6-chloro-2,3-dihydroindol-1-yl)-6,7-dimethylquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-chloro-2,3-dihydroindol-1-yl)-6,7-dimethylquinazoline?
The IUPAC name of 4-(6-chloro-2,3-dihydroindol-1-yl)-6,7-dimethylquinazoline (CID 18932855) is 4-(6-chloro-2,3-dihydroindol-1-yl)-6,7-dimethylquinazoline.
What is the SMILES notation for 4-(6-chloro-2,3-dihydroindol-1-yl)-6,7-dimethylquinazoline?
The canonical SMILES for 4-(6-chloro-2,3-dihydroindol-1-yl)-6,7-dimethylquinazoline is Cc1cc2ncnc(N3CCc4ccc(Cl)cc43)c2cc1C.
What is the InChIKey of 4-(6-chloro-2,3-dihydroindol-1-yl)-6,7-dimethylquinazoline?
The InChIKey is DLOGGEPZOLRYJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16ClN3/c1-11-7-15-16(8-12(11)2)20-10-21-18(15)22-6-5-13-3-4-14(19)9-17(13)22/h3-4,7-10H,5-6H2,1-2H3.
What are the key properties of 4-(6-chloro-2,3-dihydroindol-1-yl)-6,7-dimethylquinazoline?
4-(6-chloro-2,3-dihydroindol-1-yl)-6,7-dimethylquinazoline has a molecular weight of 309.80 g/mol, XLogP of 4.59, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-chloro-2,3-dihydroindol-1-yl)-6,7-dimethylquinazoline is sourced from PubChem (CID 18932855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).