About 6-(3,4-dichlorophenyl)-5-[4-(trifluoromethylsulfonyl)phenyl]spiro[2.4]hept-5-ene
6-(3,4-dichlorophenyl)-5-[4-(trifluoromethylsulfonyl)phenyl]spiro[2.4]hept-5-ene (PubChem CID 18933834) has the molecular formula C20H15Cl2F3O2S
and a molecular weight of 447.31 g/mol. Its IUPAC name is 6-(3,4-dichlorophenyl)-5-[4-(trifluoromethylsulfonyl)phenyl]spiro[2.4]hept-5-ene.
Molecular Properties
| Compound Name | 6-(3,4-dichlorophenyl)-5-[4-(trifluoromethylsulfonyl)phenyl]spiro[2.4]hept-5-ene |
| PubChem CID | 18933834 |
| Molecular Formula | C20H15Cl2F3O2S |
| Molecular Weight | 447.31 g/mol |
| Exact Mass | 446.01 |
| IUPAC Name | 6-(3,4-dichlorophenyl)-5-[4-(trifluoromethylsulfonyl)phenyl]spiro[2.4]hept-5-ene |
| SMILES | O=S(=O)(c1ccc(C2=C(c3ccc(Cl)c(Cl)c3)CC3(CC3)C2)cc1)C(F)(F)F |
| InChI | InChI=1S/C20H15Cl2F3O2S/c21-17-6-3-13(9-18(17)22)16-11-19(7-8-19)10-15(16)12-1-4-14(5-2-12)28(26,27)20(23,24)25/h1-6,9H,7-8,10-11H2 |
| InChIKey | GADAYYCKJRIFEA-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 447.31 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 6-(3,4-dichlorophenyl)-5-[4-(trifluoromethylsulfonyl)phenyl]spiro[2.4]hept-5-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3,4-dichlorophenyl)-5-[4-(trifluoromethylsulfonyl)phenyl]spiro[2.4]hept-5-ene?
The IUPAC name of 6-(3,4-dichlorophenyl)-5-[4-(trifluoromethylsulfonyl)phenyl]spiro[2.4]hept-5-ene (CID 18933834) is 6-(3,4-dichlorophenyl)-5-[4-(trifluoromethylsulfonyl)phenyl]spiro[2.4]hept-5-ene.
What is the SMILES notation for 6-(3,4-dichlorophenyl)-5-[4-(trifluoromethylsulfonyl)phenyl]spiro[2.4]hept-5-ene?
The canonical SMILES for 6-(3,4-dichlorophenyl)-5-[4-(trifluoromethylsulfonyl)phenyl]spiro[2.4]hept-5-ene is O=S(=O)(c1ccc(C2=C(c3ccc(Cl)c(Cl)c3)CC3(CC3)C2)cc1)C(F)(F)F.
What is the InChIKey of 6-(3,4-dichlorophenyl)-5-[4-(trifluoromethylsulfonyl)phenyl]spiro[2.4]hept-5-ene?
The InChIKey is GADAYYCKJRIFEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15Cl2F3O2S/c21-17-6-3-13(9-18(17)22)16-11-19(7-8-19)10-15(16)12-1-4-14(5-2-12)28(26,27)20(23,24)25/h1-6,9H,7-8,10-11H2.
What are the key properties of 6-(3,4-dichlorophenyl)-5-[4-(trifluoromethylsulfonyl)phenyl]spiro[2.4]hept-5-ene?
6-(3,4-dichlorophenyl)-5-[4-(trifluoromethylsulfonyl)phenyl]spiro[2.4]hept-5-ene has a molecular weight of 447.31 g/mol, XLogP of 6.77, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,4-dichlorophenyl)-5-[4-(trifluoromethylsulfonyl)phenyl]spiro[2.4]hept-5-ene is sourced from PubChem (CID 18933834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).