C15H21NO5 — CID 18934216
3-[(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)oxy]butan-2-yl prop-2-enoate (PubChem CID 18934216) has the molecular formula C15H21NO5 and a molecular weight of 295.33 g/mol. Its IUPAC name is 3-[(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)oxy]butan-2-yl prop-2-enoate.
| Compound Name | 3-[(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)oxy]butan-2-yl prop-2-enoate |
|---|---|
| PubChem CID | 18934216 |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 3-[(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)oxy]butan-2-yl prop-2-enoate |
| SMILES | C=CC(=O)OC(C)C(C)ON1C(=O)C2CCCCC2C1=O |
| InChI | InChI=1S/C15H21NO5/c1-4-13(17)20-9(2)10(3)21-16-14(18)11-7-5-6-8-12(11)15(16)19/h4,9-12H,1,5-8H2,2-3H3 |
| InChIKey | GAKFUCXCBFSVMC-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|