C20H36O5S — CID 18934385
1-(2-hydroxyethylsulfinyl)octadecane-3,6,9-trione (PubChem CID 18934385) has the molecular formula C20H36O5S and a molecular weight of 388.57 g/mol. Its IUPAC name is 1-(2-hydroxyethylsulfinyl)octadecane-3,6,9-trione.
| Compound Name | 1-(2-hydroxyethylsulfinyl)octadecane-3,6,9-trione |
|---|---|
| PubChem CID | 18934385 |
| Molecular Formula | C20H36O5S |
| Molecular Weight | 388.57 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | 1-(2-hydroxyethylsulfinyl)octadecane-3,6,9-trione |
| SMILES | CCCCCCCCCC(=O)CCC(=O)CCC(=O)CCS(=O)CCO |
| InChI | InChI=1S/C20H36O5S/c1-2-3-4-5-6-7-8-9-18(22)10-11-19(23)12-13-20(24)14-16-26(25)17-15-21/h21H,2-17H2,1H3 |
| InChIKey | HTKZUMXGXFOSOD-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.57 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|