About [N'-[6-[(2-aminoacetyl)amino]hexyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamic acid
[N'-[6-[(2-aminoacetyl)amino]hexyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamic acid (PubChem CID 18934947) has the molecular formula C15H29N5O5
and a molecular weight of 359.43 g/mol. Its IUPAC name is [N'-[6-[(2-aminoacetyl)amino]hexyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamic acid.
Molecular Properties
| Compound Name | [N'-[6-[(2-aminoacetyl)amino]hexyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamic acid |
| PubChem CID | 18934947 |
| Molecular Formula | C15H29N5O5 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | [N'-[6-[(2-aminoacetyl)amino]hexyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamic acid |
| SMILES | CC(C)(C)OC(=O)N/C(=N/CCCCCCNC(=O)CN)NC(=O)O |
| InChI | InChI=1S/C15H29N5O5/c1-15(2,3)25-14(24)20-12(19-13(22)23)18-9-7-5-4-6-8-17-11(21)10-16/h4-10,16H2,1-3H3,(H,17,21)(H,22,23)(H2,18,19,20,24) |
| InChIKey | CPAUHKYGCZVVPF-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 155.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [N'-[6-[(2-aminoacetyl)amino]hexyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [N'-[6-[(2-aminoacetyl)amino]hexyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamic acid?
The IUPAC name of [N'-[6-[(2-aminoacetyl)amino]hexyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamic acid (CID 18934947) is [N'-[6-[(2-aminoacetyl)amino]hexyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamic acid.
What is the SMILES notation for [N'-[6-[(2-aminoacetyl)amino]hexyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamic acid?
The canonical SMILES for [N'-[6-[(2-aminoacetyl)amino]hexyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamic acid is CC(C)(C)OC(=O)N/C(=N/CCCCCCNC(=O)CN)NC(=O)O.
What is the InChIKey of [N'-[6-[(2-aminoacetyl)amino]hexyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamic acid?
The InChIKey is CPAUHKYGCZVVPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29N5O5/c1-15(2,3)25-14(24)20-12(19-13(22)23)18-9-7-5-4-6-8-17-11(21)10-16/h4-10,16H2,1-3H3,(H,17,21)(H,22,23)(H2,18,19,20,24).
What are the key properties of [N'-[6-[(2-aminoacetyl)amino]hexyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamic acid?
[N'-[6-[(2-aminoacetyl)amino]hexyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamic acid has a molecular weight of 359.43 g/mol, XLogP of 0.77, 8 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [N'-[6-[(2-aminoacetyl)amino]hexyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamic acid is sourced from PubChem (CID 18934947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).