C29H53N7O11 — CID 18934959
3-[4-[[2-[6-[[(carboxyamino)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]amino]hexylamino]-2-oxoethyl]carbamoyloxy]butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propylcarbamic acid (PubChem CID 18934959) has the molecular formula C29H53N7O11 and a molecular weight of 675.78 g/mol. Its IUPAC name is 3-[4-[[2-[6-[[(carboxyamino)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]amino]hexylamino]-2-oxoethyl]carbamoyloxy]butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propylcarbamic acid.
| Compound Name | 3-[4-[[2-[6-[[(carboxyamino)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]amino]hexylamino]-2-oxoethyl]carbamoyloxy]butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propylcarbamic acid |
|---|---|
| PubChem CID | 18934959 |
| Molecular Formula | C29H53N7O11 |
| Molecular Weight | 675.78 g/mol |
| Exact Mass | 675.38 |
| IUPAC Name | 3-[4-[[2-[6-[[(carboxyamino)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]amino]hexylamino]-2-oxoethyl]carbamoyloxy]butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propylcarbamic acid |
| SMILES | CC(C)(C)OC(=O)N/C(=N/CCCCCCNC(=O)CNC(=O)OCCCCN(CCCNC(=O)O)C(=O)OC(C)(C)C)NC(=O)O |
| InChI | InChI=1S/C29H53N7O11/c1-28(2,3)46-26(43)35-22(34-24(40)41)31-15-10-8-7-9-14-30-21(37)20-33-25(42)45-19-12-11-17-36(18-13-16-32-23(38)39)27(44)47-29(4,5)6/h32H,7-20H2,1-6H3,(H,30,37)(H,33,42)(H,38,39)(H,40,41)(H2,31,34,35,43) |
| InChIKey | QMTASIFJEHLRCY-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 246.32 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.78 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|