C48H74N6O2 — CID 18934994
3-[4-(azocan-1-yl)phenyl]-1-[[4-[[[4-(azocan-1-yl)phenyl]carbamoyl-cyclohexylamino]methyl]cyclohexyl]methyl]-1-cyclohexylurea (PubChem CID 18934994) has the molecular formula C48H74N6O2 and a molecular weight of 767.16 g/mol. Its IUPAC name is 3-[4-(azocan-1-yl)phenyl]-1-[[4-[[[4-(azocan-1-yl)phenyl]carbamoyl-cyclohexylamino]methyl]cyclohexyl]methyl]-1-cyclohexylurea.
| Compound Name | 3-[4-(azocan-1-yl)phenyl]-1-[[4-[[[4-(azocan-1-yl)phenyl]carbamoyl-cyclohexylamino]methyl]cyclohexyl]methyl]-1-cyclohexylurea |
|---|---|
| PubChem CID | 18934994 |
| Molecular Formula | C48H74N6O2 |
| Molecular Weight | 767.16 g/mol |
| Exact Mass | 766.59 |
| IUPAC Name | 3-[4-(azocan-1-yl)phenyl]-1-[[4-[[[4-(azocan-1-yl)phenyl]carbamoyl-cyclohexylamino]methyl]cyclohexyl]methyl]-1-cyclohexylurea |
| SMILES | O=C(Nc1ccc(N2CCCCCCC2)cc1)N(CC1CCC(CN(C(=O)Nc2ccc(N3CCCCCCC3)cc2)C2CCCCC2)CC1)C1CCCCC1 |
| InChI | InChI=1S/C48H74N6O2/c55-47(49-41-25-29-43(30-26-41)51-33-13-3-1-4-14-34-51)53(45-17-9-7-10-18-45)37-39-21-23-40(24-22-39)38-54(46-19-11-8-12-20-46)48(56)50-42-27-31-44(32-28-42)52-35-15-5-2-6-16-36-52/h25-32,39-40,45-46H,1-24,33-38H2,(H,49,55)(H,50,56) |
| InChIKey | MGXSOQNFZKVOLX-UHFFFAOYSA-N |
| XLogP | 12.07 |
| TPSA | 71.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.16 |
| LogP ≤ 5 | 12.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|