About CID 18935206
CID 18935206 (PubChem CID 18935206) has the molecular formula C6H4ClN2OSi
and a molecular weight of 183.65 g/mol.
Molecular Properties
| Compound Name | CID 18935206 |
| PubChem CID | 18935206 |
| Molecular Formula | C6H4ClN2OSi |
| Molecular Weight | 183.65 g/mol |
| Exact Mass | 182.98 |
| IUPAC Name | — |
| SMILES | NC(=O)c1c([Si])ccnc1Cl |
| InChI | InChI=1S/C6H4ClN2OSi/c7-5-4(6(8)10)3(11)1-2-9-5/h1-2H,(H2,8,10) |
| InChIKey | VKEOEPMVIJKURT-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.65 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 18935206 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 18935206?
The IUPAC name of CID 18935206 (CID 18935206) is not available.
What is the SMILES notation for CID 18935206?
The canonical SMILES for CID 18935206 is NC(=O)c1c([Si])ccnc1Cl.
What is the InChIKey of CID 18935206?
The InChIKey is VKEOEPMVIJKURT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4ClN2OSi/c7-5-4(6(8)10)3(11)1-2-9-5/h1-2H,(H2,8,10).
What are the key properties of CID 18935206?
CID 18935206 has a molecular weight of 183.65 g/mol, XLogP of -0.37, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 18935206 is sourced from PubChem (CID 18935206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).