About (6-hydroxy-1-methyl-3,4-dihydro-2H-isoquinolin-1-yl)carbamic acid
(6-hydroxy-1-methyl-3,4-dihydro-2H-isoquinolin-1-yl)carbamic acid (PubChem CID 18935215) has the molecular formula C11H14N2O3
and a molecular weight of 222.24 g/mol. Its IUPAC name is (6-hydroxy-1-methyl-3,4-dihydro-2H-isoquinolin-1-yl)carbamic acid.
Molecular Properties
| Compound Name | (6-hydroxy-1-methyl-3,4-dihydro-2H-isoquinolin-1-yl)carbamic acid |
| PubChem CID | 18935215 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | (6-hydroxy-1-methyl-3,4-dihydro-2H-isoquinolin-1-yl)carbamic acid |
| SMILES | CC1(NC(=O)O)NCCc2cc(O)ccc21 |
| InChI | InChI=1S/C11H14N2O3/c1-11(13-10(15)16)9-3-2-8(14)6-7(9)4-5-12-11/h2-3,6,12-14H,4-5H2,1H3,(H,15,16) |
| InChIKey | RUSHHOONHQLZIZ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (6-hydroxy-1-methyl-3,4-dihydro-2H-isoquinolin-1-yl)carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-hydroxy-1-methyl-3,4-dihydro-2H-isoquinolin-1-yl)carbamic acid?
The IUPAC name of (6-hydroxy-1-methyl-3,4-dihydro-2H-isoquinolin-1-yl)carbamic acid (CID 18935215) is (6-hydroxy-1-methyl-3,4-dihydro-2H-isoquinolin-1-yl)carbamic acid.
What is the SMILES notation for (6-hydroxy-1-methyl-3,4-dihydro-2H-isoquinolin-1-yl)carbamic acid?
The canonical SMILES for (6-hydroxy-1-methyl-3,4-dihydro-2H-isoquinolin-1-yl)carbamic acid is CC1(NC(=O)O)NCCc2cc(O)ccc21.
What is the InChIKey of (6-hydroxy-1-methyl-3,4-dihydro-2H-isoquinolin-1-yl)carbamic acid?
The InChIKey is RUSHHOONHQLZIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O3/c1-11(13-10(15)16)9-3-2-8(14)6-7(9)4-5-12-11/h2-3,6,12-14H,4-5H2,1H3,(H,15,16).
What are the key properties of (6-hydroxy-1-methyl-3,4-dihydro-2H-isoquinolin-1-yl)carbamic acid?
(6-hydroxy-1-methyl-3,4-dihydro-2H-isoquinolin-1-yl)carbamic acid has a molecular weight of 222.24 g/mol, XLogP of 0.98, 1 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6-hydroxy-1-methyl-3,4-dihydro-2H-isoquinolin-1-yl)carbamic acid is sourced from PubChem (CID 18935215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).