About 1-[3-(trifluoromethyl)-1,2,4-triazol-4-yl]ethanesulfonic acid
1-[3-(trifluoromethyl)-1,2,4-triazol-4-yl]ethanesulfonic acid (PubChem CID 18935491) has the molecular formula C5H6F3N3O3S
and a molecular weight of 245.18 g/mol. Its IUPAC name is 1-[3-(trifluoromethyl)-1,2,4-triazol-4-yl]ethanesulfonic acid.
Molecular Properties
| Compound Name | 1-[3-(trifluoromethyl)-1,2,4-triazol-4-yl]ethanesulfonic acid |
| PubChem CID | 18935491 |
| Molecular Formula | C5H6F3N3O3S |
| Molecular Weight | 245.18 g/mol |
| Exact Mass | 245.01 |
| IUPAC Name | 1-[3-(trifluoromethyl)-1,2,4-triazol-4-yl]ethanesulfonic acid |
| SMILES | CC(n1cnnc1C(F)(F)F)S(=O)(=O)O |
| InChI | InChI=1S/C5H6F3N3O3S/c1-3(15(12,13)14)11-2-9-10-4(11)5(6,7)8/h2-3H,1H3,(H,12,13,14) |
| InChIKey | KDLDHEOXUVGERW-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.18 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-(trifluoromethyl)-1,2,4-triazol-4-yl]ethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(trifluoromethyl)-1,2,4-triazol-4-yl]ethanesulfonic acid?
The IUPAC name of 1-[3-(trifluoromethyl)-1,2,4-triazol-4-yl]ethanesulfonic acid (CID 18935491) is 1-[3-(trifluoromethyl)-1,2,4-triazol-4-yl]ethanesulfonic acid.
What is the SMILES notation for 1-[3-(trifluoromethyl)-1,2,4-triazol-4-yl]ethanesulfonic acid?
The canonical SMILES for 1-[3-(trifluoromethyl)-1,2,4-triazol-4-yl]ethanesulfonic acid is CC(n1cnnc1C(F)(F)F)S(=O)(=O)O.
What is the InChIKey of 1-[3-(trifluoromethyl)-1,2,4-triazol-4-yl]ethanesulfonic acid?
The InChIKey is KDLDHEOXUVGERW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6F3N3O3S/c1-3(15(12,13)14)11-2-9-10-4(11)5(6,7)8/h2-3H,1H3,(H,12,13,14).
What are the key properties of 1-[3-(trifluoromethyl)-1,2,4-triazol-4-yl]ethanesulfonic acid?
1-[3-(trifluoromethyl)-1,2,4-triazol-4-yl]ethanesulfonic acid has a molecular weight of 245.18 g/mol, XLogP of 0.70, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(trifluoromethyl)-1,2,4-triazol-4-yl]ethanesulfonic acid is sourced from PubChem (CID 18935491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).