C27H42F2Si — CID 18935830
4-[2-[4-[4-(2,2-difluoroethenyl)phenyl]cyclohexyl]ethyl]-1-methyl-1-pentylsilinane (PubChem CID 18935830) has the molecular formula C27H42F2Si and a molecular weight of 432.72 g/mol. Its IUPAC name is 4-[2-[4-[4-(2,2-difluoroethenyl)phenyl]cyclohexyl]ethyl]-1-methyl-1-pentylsilinane.
| Compound Name | 4-[2-[4-[4-(2,2-difluoroethenyl)phenyl]cyclohexyl]ethyl]-1-methyl-1-pentylsilinane |
|---|---|
| PubChem CID | 18935830 |
| Molecular Formula | C27H42F2Si |
| Molecular Weight | 432.72 g/mol |
| Exact Mass | 432.30 |
| IUPAC Name | 4-[2-[4-[4-(2,2-difluoroethenyl)phenyl]cyclohexyl]ethyl]-1-methyl-1-pentylsilinane |
| SMILES | CCCCC[Si]1(C)CCC(CCC2CCC(c3ccc(C=C(F)F)cc3)CC2)CC1 |
| InChI | InChI=1S/C27H42F2Si/c1-3-4-5-18-30(2)19-16-23(17-20-30)7-6-22-8-12-25(13-9-22)26-14-10-24(11-15-26)21-27(28)29/h10-11,14-15,21-23,25H,3-9,12-13,16-20H2,1-2H3 |
| InChIKey | OTQTZMXNQGDOSN-UHFFFAOYSA-N |
| XLogP | 9.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.72 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|