C26H21F9O3 — CID 18935891
1-[1,1-bis[4-(1,1,2-trifluoroethoxy)phenyl]ethyl]-4-(1,1,2-trifluoroethoxy)benzene (PubChem CID 18935891) has the molecular formula C26H21F9O3 and a molecular weight of 552.43 g/mol. Its IUPAC name is 1-[1,1-bis[4-(1,1,2-trifluoroethoxy)phenyl]ethyl]-4-(1,1,2-trifluoroethoxy)benzene.
| Compound Name | 1-[1,1-bis[4-(1,1,2-trifluoroethoxy)phenyl]ethyl]-4-(1,1,2-trifluoroethoxy)benzene |
|---|---|
| PubChem CID | 18935891 |
| Molecular Formula | C26H21F9O3 |
| Molecular Weight | 552.43 g/mol |
| Exact Mass | 552.13 |
| IUPAC Name | 1-[1,1-bis[4-(1,1,2-trifluoroethoxy)phenyl]ethyl]-4-(1,1,2-trifluoroethoxy)benzene |
| SMILES | CC(c1ccc(OC(F)(F)CF)cc1)(c1ccc(OC(F)(F)CF)cc1)c1ccc(OC(F)(F)CF)cc1 |
| InChI | InChI=1S/C26H21F9O3/c1-23(17-2-8-20(9-3-17)36-24(30,31)14-27,18-4-10-21(11-5-18)37-25(32,33)15-28)19-6-12-22(13-7-19)38-26(34,35)16-29/h2-13H,14-16H2,1H3 |
| InChIKey | XXOWZDHLTHBXHY-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.43 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|