About 2,2-di(cyclopenten-1-yloxy)ethyl 2-methylprop-2-enoate;prop-2-enoic acid
2,2-di(cyclopenten-1-yloxy)ethyl 2-methylprop-2-enoate;prop-2-enoic acid (PubChem CID 18935928) has the molecular formula C19H26O6
and a molecular weight of 350.41 g/mol. Its IUPAC name is 2,2-di(cyclopenten-1-yloxy)ethyl 2-methylprop-2-enoate;prop-2-enoic acid.
Molecular Properties
| Compound Name | 2,2-di(cyclopenten-1-yloxy)ethyl 2-methylprop-2-enoate;prop-2-enoic acid |
| PubChem CID | 18935928 |
| Molecular Formula | C19H26O6 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 2,2-di(cyclopenten-1-yloxy)ethyl 2-methylprop-2-enoate;prop-2-enoic acid |
| SMILES | C=C(C)C(=O)OCC(OC1=CCCC1)OC1=CCCC1.C=CC(=O)O |
| InChI | InChI=1S/C16H22O4.C3H4O2/c1-12(2)16(17)18-11-15(19-13-7-3-4-8-13)20-14-9-5-6-10-14;1-2-3(4)5/h7,9,15H,1,3-6,8,10-11H2,2H3;2H,1H2,(H,4,5) |
| InChIKey | OWBAMUYMIDDURS-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2,2-di(cyclopenten-1-yloxy)ethyl 2-methylprop-2-enoate;prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-di(cyclopenten-1-yloxy)ethyl 2-methylprop-2-enoate;prop-2-enoic acid?
The IUPAC name of 2,2-di(cyclopenten-1-yloxy)ethyl 2-methylprop-2-enoate;prop-2-enoic acid (CID 18935928) is 2,2-di(cyclopenten-1-yloxy)ethyl 2-methylprop-2-enoate;prop-2-enoic acid.
What is the SMILES notation for 2,2-di(cyclopenten-1-yloxy)ethyl 2-methylprop-2-enoate;prop-2-enoic acid?
The canonical SMILES for 2,2-di(cyclopenten-1-yloxy)ethyl 2-methylprop-2-enoate;prop-2-enoic acid is C=C(C)C(=O)OCC(OC1=CCCC1)OC1=CCCC1.C=CC(=O)O.
What is the InChIKey of 2,2-di(cyclopenten-1-yloxy)ethyl 2-methylprop-2-enoate;prop-2-enoic acid?
The InChIKey is OWBAMUYMIDDURS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O4.C3H4O2/c1-12(2)16(17)18-11-15(19-13-7-3-4-8-13)20-14-9-5-6-10-14;1-2-3(4)5/h7,9,15H,1,3-6,8,10-11H2,2H3;2H,1H2,(H,4,5).
What are the key properties of 2,2-di(cyclopenten-1-yloxy)ethyl 2-methylprop-2-enoate;prop-2-enoic acid?
2,2-di(cyclopenten-1-yloxy)ethyl 2-methylprop-2-enoate;prop-2-enoic acid has a molecular weight of 350.41 g/mol, XLogP of 3.86, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-di(cyclopenten-1-yloxy)ethyl 2-methylprop-2-enoate;prop-2-enoic acid is sourced from PubChem (CID 18935928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).