About 1-ethoxypropan-1-ol;N-ethylethanamine
1-ethoxypropan-1-ol;N-ethylethanamine (PubChem CID 18935970) has the molecular formula C9H23NO2
and a molecular weight of 177.29 g/mol. Its IUPAC name is 1-ethoxypropan-1-ol;N-ethylethanamine.
Molecular Properties
| Compound Name | 1-ethoxypropan-1-ol;N-ethylethanamine |
| PubChem CID | 18935970 |
| Molecular Formula | C9H23NO2 |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.17 |
| IUPAC Name | 1-ethoxypropan-1-ol;N-ethylethanamine |
| SMILES | CCNCC.CCOC(O)CC |
| InChI | InChI=1S/C5H12O2.C4H11N/c1-3-5(6)7-4-2;1-3-5-4-2/h5-6H,3-4H2,1-2H3;5H,3-4H2,1-2H3 |
| InChIKey | ANEONOFBZQGWGD-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-ethoxypropan-1-ol;N-ethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxypropan-1-ol;N-ethylethanamine?
The IUPAC name of 1-ethoxypropan-1-ol;N-ethylethanamine (CID 18935970) is 1-ethoxypropan-1-ol;N-ethylethanamine.
What is the SMILES notation for 1-ethoxypropan-1-ol;N-ethylethanamine?
The canonical SMILES for 1-ethoxypropan-1-ol;N-ethylethanamine is CCNCC.CCOC(O)CC.
What is the InChIKey of 1-ethoxypropan-1-ol;N-ethylethanamine?
The InChIKey is ANEONOFBZQGWGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O2.C4H11N/c1-3-5(6)7-4-2;1-3-5-4-2/h5-6H,3-4H2,1-2H3;5H,3-4H2,1-2H3.
What are the key properties of 1-ethoxypropan-1-ol;N-ethylethanamine?
1-ethoxypropan-1-ol;N-ethylethanamine has a molecular weight of 177.29 g/mol, XLogP of 1.37, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxypropan-1-ol;N-ethylethanamine is sourced from PubChem (CID 18935970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).