C23H22ClF3N4O5S2 — CID 18936129
3-[[3-[(4-chloro-1-benzothiophen-2-yl)sulfonyl-methylamino]-2-oxopyrrolidin-1-yl]methyl]benzenecarboximidamide;2,2,2-trifluoroacetic acid (PubChem CID 18936129) has the molecular formula C23H22ClF3N4O5S2 and a molecular weight of 591.03 g/mol. Its IUPAC name is 3-[[3-[(4-chloro-1-benzothiophen-2-yl)sulfonyl-methylamino]-2-oxopyrrolidin-1-yl]methyl]benzenecarboximidamide;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[[3-[(4-chloro-1-benzothiophen-2-yl)sulfonyl-methylamino]-2-oxopyrrolidin-1-yl]methyl]benzenecarboximidamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 18936129 |
| Molecular Formula | C23H22ClF3N4O5S2 |
| Molecular Weight | 591.03 g/mol |
| Exact Mass | 590.07 |
| IUPAC Name | 3-[[3-[(4-chloro-1-benzothiophen-2-yl)sulfonyl-methylamino]-2-oxopyrrolidin-1-yl]methyl]benzenecarboximidamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1cccc(CN2CCC(N(C)S(=O)(=O)c3cc4c(Cl)cccc4s3)C2=O)c1 |
| InChI | InChI=1S/C21H21ClN4O3S2.C2HF3O2/c1-25(31(28,29)19-11-15-16(22)6-3-7-18(15)30-19)17-8-9-26(21(17)27)12-13-4-2-5-14(10-13)20(23)24;3-2(4,5)1(6)7/h2-7,10-11,17H,8-9,12H2,1H3,(H3,23,24);(H,6,7) |
| InChIKey | CSJAEKHKTGWPSA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 144.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.03 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|