C11H16N2 — CID 18936246
3a,5,6,7,8,8a,9,9a-octahydro-1H-pyrrolo[2,3-g]isoquinoline (PubChem CID 18936246) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 3a,5,6,7,8,8a,9,9a-octahydro-1H-pyrrolo[2,3-g]isoquinoline.
| Compound Name | 3a,5,6,7,8,8a,9,9a-octahydro-1H-pyrrolo[2,3-g]isoquinoline |
|---|---|
| PubChem CID | 18936246 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 3a,5,6,7,8,8a,9,9a-octahydro-1H-pyrrolo[2,3-g]isoquinoline |
| SMILES | C1=CC2C=C3CNCCC3CC2N1 |
| InChI | InChI=1S/C11H16N2/c1-3-12-7-10-5-9-2-4-13-11(9)6-8(1)10/h2,4-5,8-9,11-13H,1,3,6-7H2 |
| InChIKey | GJGAQFHTIMUSFL-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|