C21H29NO2S — CID 18936371
(5Z)-3-cyclopropyl-5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 18936371) has the molecular formula C21H29NO2S and a molecular weight of 359.54 g/mol. Its IUPAC name is (5Z)-3-cyclopropyl-5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-cyclopropyl-5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18936371 |
| Molecular Formula | C21H29NO2S |
| Molecular Weight | 359.54 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | (5Z)-3-cyclopropyl-5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | CC(C)(C)c1cc(/C=C2\SCN(C3CC3)C2=O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C21H29NO2S/c1-20(2,3)15-9-13(10-16(18(15)23)21(4,5)6)11-17-19(24)22(12-25-17)14-7-8-14/h9-11,14,23H,7-8,12H2,1-6H3/b17-11- |
| InChIKey | HVXNMJQIPMLDGM-BOPFTXTBSA-N |
| XLogP | 5.02 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.54 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|