C27H33N3O5 — CID 18936482
N-[(2,6-dimethoxy-4-methylphenyl)-(3-methoxypropyl)carbamoyl]-N-methyl-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene-6-carboxamide (PubChem CID 18936482) has the molecular formula C27H33N3O5 and a molecular weight of 479.58 g/mol. Its IUPAC name is N-[(2,6-dimethoxy-4-methylphenyl)-(3-methoxypropyl)carbamoyl]-N-methyl-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene-6-carboxamide.
| Compound Name | N-[(2,6-dimethoxy-4-methylphenyl)-(3-methoxypropyl)carbamoyl]-N-methyl-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene-6-carboxamide |
|---|---|
| PubChem CID | 18936482 |
| Molecular Formula | C27H33N3O5 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | N-[(2,6-dimethoxy-4-methylphenyl)-(3-methoxypropyl)carbamoyl]-N-methyl-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene-6-carboxamide |
| SMILES | COCCCN(C(=O)N(C)C(=O)c1cc2c3c(ccn3CCC2)c1)c1c(OC)cc(C)cc1OC |
| InChI | InChI=1S/C27H33N3O5/c1-18-14-22(34-4)25(23(15-18)35-5)30(11-7-13-33-3)27(32)28(2)26(31)21-16-19-8-6-10-29-12-9-20(17-21)24(19)29/h9,12,14-17H,6-8,10-11,13H2,1-5H3 |
| InChIKey | XMDCGHPFPUKEMA-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 73.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|