C13H15ClF6N5O4P — CID 18936549
[3-[1-(2-amino-6-chloropurin-9-yl)propan-2-yloxy]-1,1,1,5,5,5-hexafluoropentan-3-yl]phosphonic acid (PubChem CID 18936549) has the molecular formula C13H15ClF6N5O4P and a molecular weight of 485.71 g/mol. Its IUPAC name is [3-[1-(2-amino-6-chloropurin-9-yl)propan-2-yloxy]-1,1,1,5,5,5-hexafluoropentan-3-yl]phosphonic acid.
| Compound Name | [3-[1-(2-amino-6-chloropurin-9-yl)propan-2-yloxy]-1,1,1,5,5,5-hexafluoropentan-3-yl]phosphonic acid |
|---|---|
| PubChem CID | 18936549 |
| Molecular Formula | C13H15ClF6N5O4P |
| Molecular Weight | 485.71 g/mol |
| Exact Mass | 485.05 |
| IUPAC Name | [3-[1-(2-amino-6-chloropurin-9-yl)propan-2-yloxy]-1,1,1,5,5,5-hexafluoropentan-3-yl]phosphonic acid |
| SMILES | CC(Cn1cnc2c(Cl)nc(N)nc21)OC(CC(F)(F)F)(CC(F)(F)F)P(=O)(O)O |
| InChI | InChI=1S/C13H15ClF6N5O4P/c1-6(2-25-5-22-7-8(14)23-10(21)24-9(7)25)29-11(30(26,27)28,3-12(15,16)17)4-13(18,19)20/h5-6H,2-4H2,1H3,(H2,21,23,24)(H2,26,27,28) |
| InChIKey | MKZWHEZJSJSXFV-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 136.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.71 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|