About 6-fluoro-3-pyrrolidin-3-yl-2,1-benzoxazole
6-fluoro-3-pyrrolidin-3-yl-2,1-benzoxazole (PubChem CID 18936618) has the molecular formula C11H11FN2O
and a molecular weight of 206.22 g/mol. Its IUPAC name is 6-fluoro-3-pyrrolidin-3-yl-2,1-benzoxazole.
Molecular Properties
| Compound Name | 6-fluoro-3-pyrrolidin-3-yl-2,1-benzoxazole |
| PubChem CID | 18936618 |
| Molecular Formula | C11H11FN2O |
| Molecular Weight | 206.22 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 6-fluoro-3-pyrrolidin-3-yl-2,1-benzoxazole |
| SMILES | Fc1ccc2c(C3CCNC3)onc2c1 |
| InChI | InChI=1S/C11H11FN2O/c12-8-1-2-9-10(5-8)14-15-11(9)7-3-4-13-6-7/h1-2,5,7,13H,3-4,6H2 |
| InChIKey | CYIUHDRBEJNYAV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.22 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-fluoro-3-pyrrolidin-3-yl-2,1-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-3-pyrrolidin-3-yl-2,1-benzoxazole?
The IUPAC name of 6-fluoro-3-pyrrolidin-3-yl-2,1-benzoxazole (CID 18936618) is 6-fluoro-3-pyrrolidin-3-yl-2,1-benzoxazole.
What is the SMILES notation for 6-fluoro-3-pyrrolidin-3-yl-2,1-benzoxazole?
The canonical SMILES for 6-fluoro-3-pyrrolidin-3-yl-2,1-benzoxazole is Fc1ccc2c(C3CCNC3)onc2c1.
What is the InChIKey of 6-fluoro-3-pyrrolidin-3-yl-2,1-benzoxazole?
The InChIKey is CYIUHDRBEJNYAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11FN2O/c12-8-1-2-9-10(5-8)14-15-11(9)7-3-4-13-6-7/h1-2,5,7,13H,3-4,6H2.
What are the key properties of 6-fluoro-3-pyrrolidin-3-yl-2,1-benzoxazole?
6-fluoro-3-pyrrolidin-3-yl-2,1-benzoxazole has a molecular weight of 206.22 g/mol, XLogP of 2.04, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-3-pyrrolidin-3-yl-2,1-benzoxazole is sourced from PubChem (CID 18936618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).