C11H12O2 — CID 18936951
3-hydroxy-1,2,3,4-tetrahydronaphthalene-2-carbaldehyde (PubChem CID 18936951) has the molecular formula C11H12O2 and a molecular weight of 176.22 g/mol. Its IUPAC name is 3-hydroxy-1,2,3,4-tetrahydronaphthalene-2-carbaldehyde.
| Compound Name | 3-hydroxy-1,2,3,4-tetrahydronaphthalene-2-carbaldehyde |
|---|---|
| PubChem CID | 18936951 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 3-hydroxy-1,2,3,4-tetrahydronaphthalene-2-carbaldehyde |
| SMILES | O=CC1Cc2ccccc2CC1O |
| InChI | InChI=1S/C11H12O2/c12-7-10-5-8-3-1-2-4-9(8)6-11(10)13/h1-4,7,10-11,13H,5-6H2 |
| InChIKey | XXXFDLJKFLSOPF-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|