C14H16F5N3O3S — CID 18937302
N-(diaminomethylidene)-3-methylsulfonyl-2-(1,1,2,2,2-pentafluoroethyl)-4-propylbenzamide (PubChem CID 18937302) has the molecular formula C14H16F5N3O3S and a molecular weight of 401.36 g/mol. Its IUPAC name is N-(diaminomethylidene)-3-methylsulfonyl-2-(1,1,2,2,2-pentafluoroethyl)-4-propylbenzamide.
| Compound Name | N-(diaminomethylidene)-3-methylsulfonyl-2-(1,1,2,2,2-pentafluoroethyl)-4-propylbenzamide |
|---|---|
| PubChem CID | 18937302 |
| Molecular Formula | C14H16F5N3O3S |
| Molecular Weight | 401.36 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | N-(diaminomethylidene)-3-methylsulfonyl-2-(1,1,2,2,2-pentafluoroethyl)-4-propylbenzamide |
| SMILES | CCCc1ccc(C(=O)N=C(N)N)c(C(F)(F)C(F)(F)F)c1S(C)(=O)=O |
| InChI | InChI=1S/C14H16F5N3O3S/c1-3-4-7-5-6-8(11(23)22-12(20)21)9(10(7)26(2,24)25)13(15,16)14(17,18)19/h5-6H,3-4H2,1-2H3,(H4,20,21,22,23) |
| InChIKey | OCISPJFLDLCMBE-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|