About 4-bromo-2,3-dimethyl-5-methylsulfonylbenzoyl chloride
4-bromo-2,3-dimethyl-5-methylsulfonylbenzoyl chloride (PubChem CID 18937386) has the molecular formula C10H10BrClO3S
and a molecular weight of 325.61 g/mol. Its IUPAC name is 4-bromo-2,3-dimethyl-5-methylsulfonylbenzoyl chloride.
Molecular Properties
| Compound Name | 4-bromo-2,3-dimethyl-5-methylsulfonylbenzoyl chloride |
| PubChem CID | 18937386 |
| Molecular Formula | C10H10BrClO3S |
| Molecular Weight | 325.61 g/mol |
| Exact Mass | 323.92 |
| IUPAC Name | 4-bromo-2,3-dimethyl-5-methylsulfonylbenzoyl chloride |
| SMILES | Cc1c(C(=O)Cl)cc(S(C)(=O)=O)c(Br)c1C |
| InChI | InChI=1S/C10H10BrClO3S/c1-5-6(2)9(11)8(16(3,14)15)4-7(5)10(12)13/h4H,1-3H3 |
| InChIKey | YVUNTSGSTYHWEH-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.61 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-2,3-dimethyl-5-methylsulfonylbenzoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2,3-dimethyl-5-methylsulfonylbenzoyl chloride?
The IUPAC name of 4-bromo-2,3-dimethyl-5-methylsulfonylbenzoyl chloride (CID 18937386) is 4-bromo-2,3-dimethyl-5-methylsulfonylbenzoyl chloride.
What is the SMILES notation for 4-bromo-2,3-dimethyl-5-methylsulfonylbenzoyl chloride?
The canonical SMILES for 4-bromo-2,3-dimethyl-5-methylsulfonylbenzoyl chloride is Cc1c(C(=O)Cl)cc(S(C)(=O)=O)c(Br)c1C.
What is the InChIKey of 4-bromo-2,3-dimethyl-5-methylsulfonylbenzoyl chloride?
The InChIKey is YVUNTSGSTYHWEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BrClO3S/c1-5-6(2)9(11)8(16(3,14)15)4-7(5)10(12)13/h4H,1-3H3.
What are the key properties of 4-bromo-2,3-dimethyl-5-methylsulfonylbenzoyl chloride?
4-bromo-2,3-dimethyl-5-methylsulfonylbenzoyl chloride has a molecular weight of 325.61 g/mol, XLogP of 2.85, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2,3-dimethyl-5-methylsulfonylbenzoyl chloride is sourced from PubChem (CID 18937386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).