About 1-azatricyclo[3.3.1.13,7]decan-2-ylmethanamine
1-azatricyclo[3.3.1.13,7]decan-2-ylmethanamine (PubChem CID 18937849) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is 1-azatricyclo[3.3.1.13,7]decan-2-ylmethanamine.
Molecular Properties
| Compound Name | 1-azatricyclo[3.3.1.13,7]decan-2-ylmethanamine |
| PubChem CID | 18937849 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 1-azatricyclo[3.3.1.13,7]decan-2-ylmethanamine |
| SMILES | NCC1C2CC3CC(C2)CN1C3 |
| InChI | InChI=1S/C10H18N2/c11-4-10-9-2-7-1-8(3-9)6-12(10)5-7/h7-10H,1-6,11H2 |
| InChIKey | GAXRSARCPXSVLH-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-azatricyclo[3.3.1.13,7]decan-2-ylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azatricyclo[3.3.1.13,7]decan-2-ylmethanamine?
The IUPAC name of 1-azatricyclo[3.3.1.13,7]decan-2-ylmethanamine (CID 18937849) is 1-azatricyclo[3.3.1.13,7]decan-2-ylmethanamine.
What is the SMILES notation for 1-azatricyclo[3.3.1.13,7]decan-2-ylmethanamine?
The canonical SMILES for 1-azatricyclo[3.3.1.13,7]decan-2-ylmethanamine is NCC1C2CC3CC(C2)CN1C3.
What is the InChIKey of 1-azatricyclo[3.3.1.13,7]decan-2-ylmethanamine?
The InChIKey is GAXRSARCPXSVLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2/c11-4-10-9-2-7-1-8(3-9)6-12(10)5-7/h7-10H,1-6,11H2.
What are the key properties of 1-azatricyclo[3.3.1.13,7]decan-2-ylmethanamine?
1-azatricyclo[3.3.1.13,7]decan-2-ylmethanamine has a molecular weight of 166.27 g/mol, XLogP of 0.68, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azatricyclo[3.3.1.13,7]decan-2-ylmethanamine is sourced from PubChem (CID 18937849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).