About 5-oxo-7,8-dihydro-6H-naphthalene-1-carboximidamide;hydrochloride
5-oxo-7,8-dihydro-6H-naphthalene-1-carboximidamide;hydrochloride (PubChem CID 18937912) has the molecular formula C11H13ClN2O
and a molecular weight of 224.69 g/mol. Its IUPAC name is 5-oxo-7,8-dihydro-6H-naphthalene-1-carboximidamide;hydrochloride.
Molecular Properties
| Compound Name | 5-oxo-7,8-dihydro-6H-naphthalene-1-carboximidamide;hydrochloride |
| PubChem CID | 18937912 |
| Molecular Formula | C11H13ClN2O |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 5-oxo-7,8-dihydro-6H-naphthalene-1-carboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1cccc2c1CCCC2=O |
| InChI | InChI=1S/C11H12N2O.ClH/c12-11(13)9-5-1-4-8-7(9)3-2-6-10(8)14;/h1,4-5H,2-3,6H2,(H3,12,13);1H |
| InChIKey | WEKHLJQDSUVDMQ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 66.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 5-oxo-7,8-dihydro-6H-naphthalene-1-carboximidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-oxo-7,8-dihydro-6H-naphthalene-1-carboximidamide;hydrochloride?
The IUPAC name of 5-oxo-7,8-dihydro-6H-naphthalene-1-carboximidamide;hydrochloride (CID 18937912) is 5-oxo-7,8-dihydro-6H-naphthalene-1-carboximidamide;hydrochloride.
What is the SMILES notation for 5-oxo-7,8-dihydro-6H-naphthalene-1-carboximidamide;hydrochloride?
The canonical SMILES for 5-oxo-7,8-dihydro-6H-naphthalene-1-carboximidamide;hydrochloride is Cl.[H]/N=C(\N)c1cccc2c1CCCC2=O.
What is the InChIKey of 5-oxo-7,8-dihydro-6H-naphthalene-1-carboximidamide;hydrochloride?
The InChIKey is WEKHLJQDSUVDMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O.ClH/c12-11(13)9-5-1-4-8-7(9)3-2-6-10(8)14;/h1,4-5H,2-3,6H2,(H3,12,13);1H.
What are the key properties of 5-oxo-7,8-dihydro-6H-naphthalene-1-carboximidamide;hydrochloride?
5-oxo-7,8-dihydro-6H-naphthalene-1-carboximidamide;hydrochloride has a molecular weight of 224.69 g/mol, XLogP of 1.91, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxo-7,8-dihydro-6H-naphthalene-1-carboximidamide;hydrochloride is sourced from PubChem (CID 18937912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).