About 4,5-dihydroimidazole-1,2-diamine;hydrochloride
4,5-dihydroimidazole-1,2-diamine;hydrochloride (PubChem CID 18937940) has the molecular formula C3H9ClN4
and a molecular weight of 136.59 g/mol. Its IUPAC name is 4,5-dihydroimidazole-1,2-diamine;hydrochloride.
Molecular Properties
| Compound Name | 4,5-dihydroimidazole-1,2-diamine;hydrochloride |
| PubChem CID | 18937940 |
| Molecular Formula | C3H9ClN4 |
| Molecular Weight | 136.59 g/mol |
| Exact Mass | 136.05 |
| IUPAC Name | 4,5-dihydroimidazole-1,2-diamine;hydrochloride |
| SMILES | Cl.NC1=NCCN1N |
| InChI | InChI=1S/C3H8N4.ClH/c4-3-6-1-2-7(3)5;/h1-2,5H2,(H2,4,6);1H |
| InChIKey | LZSJXQGFFDEUBK-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.59 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dihydroimidazole-1,2-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dihydroimidazole-1,2-diamine;hydrochloride?
The IUPAC name of 4,5-dihydroimidazole-1,2-diamine;hydrochloride (CID 18937940) is 4,5-dihydroimidazole-1,2-diamine;hydrochloride.
What is the SMILES notation for 4,5-dihydroimidazole-1,2-diamine;hydrochloride?
The canonical SMILES for 4,5-dihydroimidazole-1,2-diamine;hydrochloride is Cl.NC1=NCCN1N.
What is the InChIKey of 4,5-dihydroimidazole-1,2-diamine;hydrochloride?
The InChIKey is LZSJXQGFFDEUBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8N4.ClH/c4-3-6-1-2-7(3)5;/h1-2,5H2,(H2,4,6);1H.
What are the key properties of 4,5-dihydroimidazole-1,2-diamine;hydrochloride?
4,5-dihydroimidazole-1,2-diamine;hydrochloride has a molecular weight of 136.59 g/mol, XLogP of -1.09, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dihydroimidazole-1,2-diamine;hydrochloride is sourced from PubChem (CID 18937940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).