About diphenyldiazene;1,4,8,11-tetrazacyclotetradecane
diphenyldiazene;1,4,8,11-tetrazacyclotetradecane (PubChem CID 18938641) has the molecular formula C22H34N6
and a molecular weight of 382.56 g/mol. Its IUPAC name is diphenyldiazene;1,4,8,11-tetrazacyclotetradecane.
Molecular Properties
| Compound Name | diphenyldiazene;1,4,8,11-tetrazacyclotetradecane |
| PubChem CID | 18938641 |
| Molecular Formula | C22H34N6 |
| Molecular Weight | 382.56 g/mol |
| Exact Mass | 382.28 |
| IUPAC Name | diphenyldiazene;1,4,8,11-tetrazacyclotetradecane |
| SMILES | C1CNCCNCCCNCCNC1.c1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10N2.C10H24N4/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12;1-3-11-7-9-13-5-2-6-14-10-8-12-4-1/h1-10H;11-14H,1-10H2/b14-13+; |
| InChIKey | IEKAFVQIRRPJKX-IERUDJENSA-N |
| XLogP | 3.24 |
| TPSA | 72.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.56 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze diphenyldiazene;1,4,8,11-tetrazacyclotetradecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenyldiazene;1,4,8,11-tetrazacyclotetradecane?
The IUPAC name of diphenyldiazene;1,4,8,11-tetrazacyclotetradecane (CID 18938641) is diphenyldiazene;1,4,8,11-tetrazacyclotetradecane.
What is the SMILES notation for diphenyldiazene;1,4,8,11-tetrazacyclotetradecane?
The canonical SMILES for diphenyldiazene;1,4,8,11-tetrazacyclotetradecane is C1CNCCNCCCNCCNC1.c1ccc(/N=N/c2ccccc2)cc1.
What is the InChIKey of diphenyldiazene;1,4,8,11-tetrazacyclotetradecane?
The InChIKey is IEKAFVQIRRPJKX-IERUDJENSA-N. The full InChI is InChI=1S/C12H10N2.C10H24N4/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12;1-3-11-7-9-13-5-2-6-14-10-8-12-4-1/h1-10H;11-14H,1-10H2/b14-13+;.
What are the key properties of diphenyldiazene;1,4,8,11-tetrazacyclotetradecane?
diphenyldiazene;1,4,8,11-tetrazacyclotetradecane has a molecular weight of 382.56 g/mol, XLogP of 3.24, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diphenyldiazene;1,4,8,11-tetrazacyclotetradecane is sourced from PubChem (CID 18938641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).