About 2,2-dimethoxyethylcarbamic acid
2,2-dimethoxyethylcarbamic acid (PubChem CID 18938836) has the molecular formula C5H11NO4
and a molecular weight of 149.15 g/mol. Its IUPAC name is 2,2-dimethoxyethylcarbamic acid.
Molecular Properties
| Compound Name | 2,2-dimethoxyethylcarbamic acid |
| PubChem CID | 18938836 |
| Molecular Formula | C5H11NO4 |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.07 |
| IUPAC Name | 2,2-dimethoxyethylcarbamic acid |
| SMILES | COC(CNC(=O)O)OC |
| InChI | InChI=1S/C5H11NO4/c1-9-4(10-2)3-6-5(7)8/h4,6H,3H2,1-2H3,(H,7,8) |
| InChIKey | VCLPOHRMFJHKMC-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethoxyethylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethoxyethylcarbamic acid?
The IUPAC name of 2,2-dimethoxyethylcarbamic acid (CID 18938836) is 2,2-dimethoxyethylcarbamic acid.
What is the SMILES notation for 2,2-dimethoxyethylcarbamic acid?
The canonical SMILES for 2,2-dimethoxyethylcarbamic acid is COC(CNC(=O)O)OC.
What is the InChIKey of 2,2-dimethoxyethylcarbamic acid?
The InChIKey is VCLPOHRMFJHKMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO4/c1-9-4(10-2)3-6-5(7)8/h4,6H,3H2,1-2H3,(H,7,8).
What are the key properties of 2,2-dimethoxyethylcarbamic acid?
2,2-dimethoxyethylcarbamic acid has a molecular weight of 149.15 g/mol, XLogP of -0.13, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethoxyethylcarbamic acid is sourced from PubChem (CID 18938836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).