C22H30O4 — CID 18939095
(E)-4-hydroxy-3-methyl-6-oxo-6-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)hex-2-enoic acid (PubChem CID 18939095) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is (E)-4-hydroxy-3-methyl-6-oxo-6-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)hex-2-enoic acid.
| Compound Name | (E)-4-hydroxy-3-methyl-6-oxo-6-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)hex-2-enoic acid |
|---|---|
| PubChem CID | 18939095 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | (E)-4-hydroxy-3-methyl-6-oxo-6-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)hex-2-enoic acid |
| SMILES | C/C(=C\C(=O)O)C(O)CC(=O)c1cc2c(cc1C)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C22H30O4/c1-13-9-16-17(22(5,6)8-7-21(16,3)4)11-15(13)19(24)12-18(23)14(2)10-20(25)26/h9-11,18,23H,7-8,12H2,1-6H3,(H,25,26)/b14-10+ |
| InChIKey | UUFJVCVULROMKB-GXDHUFHOSA-N |
| XLogP | 4.31 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|