About propan-2-ol;4-[2-(3-triethoxysilylpropoxy)ethoxy]benzaldehyde
propan-2-ol;4-[2-(3-triethoxysilylpropoxy)ethoxy]benzaldehyde (PubChem CID 18939126) has the molecular formula C21H38O7Si
and a molecular weight of 430.61 g/mol. Its IUPAC name is propan-2-ol;4-[2-(3-triethoxysilylpropoxy)ethoxy]benzaldehyde.
Molecular Properties
| Compound Name | propan-2-ol;4-[2-(3-triethoxysilylpropoxy)ethoxy]benzaldehyde |
| PubChem CID | 18939126 |
| Molecular Formula | C21H38O7Si |
| Molecular Weight | 430.61 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | propan-2-ol;4-[2-(3-triethoxysilylpropoxy)ethoxy]benzaldehyde |
| SMILES | CC(C)O.CCO[Si](CCCOCCOc1ccc(C=O)cc1)(OCC)OCC |
| InChI | InChI=1S/C18H30O6Si.C3H8O/c1-4-22-25(23-5-2,24-6-3)15-7-12-20-13-14-21-18-10-8-17(16-19)9-11-18;1-3(2)4/h8-11,16H,4-7,12-15H2,1-3H3;3-4H,1-2H3 |
| InChIKey | IUFXIEOOANRVCG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.61 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze propan-2-ol;4-[2-(3-triethoxysilylpropoxy)ethoxy]benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-ol;4-[2-(3-triethoxysilylpropoxy)ethoxy]benzaldehyde?
The IUPAC name of propan-2-ol;4-[2-(3-triethoxysilylpropoxy)ethoxy]benzaldehyde (CID 18939126) is propan-2-ol;4-[2-(3-triethoxysilylpropoxy)ethoxy]benzaldehyde.
What is the SMILES notation for propan-2-ol;4-[2-(3-triethoxysilylpropoxy)ethoxy]benzaldehyde?
The canonical SMILES for propan-2-ol;4-[2-(3-triethoxysilylpropoxy)ethoxy]benzaldehyde is CC(C)O.CCO[Si](CCCOCCOc1ccc(C=O)cc1)(OCC)OCC.
What is the InChIKey of propan-2-ol;4-[2-(3-triethoxysilylpropoxy)ethoxy]benzaldehyde?
The InChIKey is IUFXIEOOANRVCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30O6Si.C3H8O/c1-4-22-25(23-5-2,24-6-3)15-7-12-20-13-14-21-18-10-8-17(16-19)9-11-18;1-3(2)4/h8-11,16H,4-7,12-15H2,1-3H3;3-4H,1-2H3.
What are the key properties of propan-2-ol;4-[2-(3-triethoxysilylpropoxy)ethoxy]benzaldehyde?
propan-2-ol;4-[2-(3-triethoxysilylpropoxy)ethoxy]benzaldehyde has a molecular weight of 430.61 g/mol, XLogP of 3.72, 15 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-ol;4-[2-(3-triethoxysilylpropoxy)ethoxy]benzaldehyde is sourced from PubChem (CID 18939126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).