C13H19N2O5P — CID 18939369
1-[5-(dimethylphosphorylmethoxy)-2,5-dihydrofuran-2-yl]-5-ethylpyrimidine-2,4-dione (PubChem CID 18939369) has the molecular formula C13H19N2O5P and a molecular weight of 314.28 g/mol. Its IUPAC name is 1-[5-(dimethylphosphorylmethoxy)-2,5-dihydrofuran-2-yl]-5-ethylpyrimidine-2,4-dione.
| Compound Name | 1-[5-(dimethylphosphorylmethoxy)-2,5-dihydrofuran-2-yl]-5-ethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 18939369 |
| Molecular Formula | C13H19N2O5P |
| Molecular Weight | 314.28 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 1-[5-(dimethylphosphorylmethoxy)-2,5-dihydrofuran-2-yl]-5-ethylpyrimidine-2,4-dione |
| SMILES | CCc1cn(C2C=CC(OCP(C)(C)=O)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H19N2O5P/c1-4-9-7-15(13(17)14-12(9)16)10-5-6-11(20-10)19-8-21(2,3)18/h5-7,10-11H,4,8H2,1-3H3,(H,14,16,17) |
| InChIKey | CIABTWYHNNXKLY-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.28 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|