About 2-(dimethoxymethyl)-3,3-dimethoxypropan-1-ol
2-(dimethoxymethyl)-3,3-dimethoxypropan-1-ol (PubChem CID 18939758) has the molecular formula C8H18O5
and a molecular weight of 194.23 g/mol. Its IUPAC name is 2-(dimethoxymethyl)-3,3-dimethoxypropan-1-ol.
Molecular Properties
| Compound Name | 2-(dimethoxymethyl)-3,3-dimethoxypropan-1-ol |
| PubChem CID | 18939758 |
| Molecular Formula | C8H18O5 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 2-(dimethoxymethyl)-3,3-dimethoxypropan-1-ol |
| SMILES | COC(OC)C(CO)C(OC)OC |
| InChI | InChI=1S/C8H18O5/c1-10-7(11-2)6(5-9)8(12-3)13-4/h6-9H,5H2,1-4H3 |
| InChIKey | JQMJMUYMMSPHMY-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethoxymethyl)-3,3-dimethoxypropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethoxymethyl)-3,3-dimethoxypropan-1-ol?
The IUPAC name of 2-(dimethoxymethyl)-3,3-dimethoxypropan-1-ol (CID 18939758) is 2-(dimethoxymethyl)-3,3-dimethoxypropan-1-ol.
What is the SMILES notation for 2-(dimethoxymethyl)-3,3-dimethoxypropan-1-ol?
The canonical SMILES for 2-(dimethoxymethyl)-3,3-dimethoxypropan-1-ol is COC(OC)C(CO)C(OC)OC.
What is the InChIKey of 2-(dimethoxymethyl)-3,3-dimethoxypropan-1-ol?
The InChIKey is JQMJMUYMMSPHMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O5/c1-10-7(11-2)6(5-9)8(12-3)13-4/h6-9H,5H2,1-4H3.
What are the key properties of 2-(dimethoxymethyl)-3,3-dimethoxypropan-1-ol?
2-(dimethoxymethyl)-3,3-dimethoxypropan-1-ol has a molecular weight of 194.23 g/mol, XLogP of -0.17, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethoxymethyl)-3,3-dimethoxypropan-1-ol is sourced from PubChem (CID 18939758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).