About 1,6-difluoro-6-(4-heptylcyclohexyl)cyclohexa-1,4-diene
1,6-difluoro-6-(4-heptylcyclohexyl)cyclohexa-1,4-diene (PubChem CID 18940005) has the molecular formula C19H30F2
and a molecular weight of 296.45 g/mol. Its IUPAC name is 1,6-difluoro-6-(4-heptylcyclohexyl)cyclohexa-1,4-diene.
Molecular Properties
| Compound Name | 1,6-difluoro-6-(4-heptylcyclohexyl)cyclohexa-1,4-diene |
| PubChem CID | 18940005 |
| Molecular Formula | C19H30F2 |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | 1,6-difluoro-6-(4-heptylcyclohexyl)cyclohexa-1,4-diene |
| SMILES | CCCCCCCC1CCC(C2(F)C=CCC=C2F)CC1 |
| InChI | InChI=1S/C19H30F2/c1-2-3-4-5-6-9-16-11-13-17(14-12-16)19(21)15-8-7-10-18(19)20/h8,10,15-17H,2-7,9,11-14H2,1H3 |
| InChIKey | CUQMXGFNATUPHZ-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,6-difluoro-6-(4-heptylcyclohexyl)cyclohexa-1,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-difluoro-6-(4-heptylcyclohexyl)cyclohexa-1,4-diene?
The IUPAC name of 1,6-difluoro-6-(4-heptylcyclohexyl)cyclohexa-1,4-diene (CID 18940005) is 1,6-difluoro-6-(4-heptylcyclohexyl)cyclohexa-1,4-diene.
What is the SMILES notation for 1,6-difluoro-6-(4-heptylcyclohexyl)cyclohexa-1,4-diene?
The canonical SMILES for 1,6-difluoro-6-(4-heptylcyclohexyl)cyclohexa-1,4-diene is CCCCCCCC1CCC(C2(F)C=CCC=C2F)CC1.
What is the InChIKey of 1,6-difluoro-6-(4-heptylcyclohexyl)cyclohexa-1,4-diene?
The InChIKey is CUQMXGFNATUPHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30F2/c1-2-3-4-5-6-9-16-11-13-17(14-12-16)19(21)15-8-7-10-18(19)20/h8,10,15-17H,2-7,9,11-14H2,1H3.
What are the key properties of 1,6-difluoro-6-(4-heptylcyclohexyl)cyclohexa-1,4-diene?
1,6-difluoro-6-(4-heptylcyclohexyl)cyclohexa-1,4-diene has a molecular weight of 296.45 g/mol, XLogP of 6.67, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-difluoro-6-(4-heptylcyclohexyl)cyclohexa-1,4-diene is sourced from PubChem (CID 18940005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).