About 1,3-dibenzyl-4-(trifluoromethyl)-3H-1,5-benzodiazepin-2-one
1,3-dibenzyl-4-(trifluoromethyl)-3H-1,5-benzodiazepin-2-one (PubChem CID 18940592) has the molecular formula C24H19F3N2O
and a molecular weight of 408.42 g/mol. Its IUPAC name is 1,3-dibenzyl-4-(trifluoromethyl)-3H-1,5-benzodiazepin-2-one.
Molecular Properties
| Compound Name | 1,3-dibenzyl-4-(trifluoromethyl)-3H-1,5-benzodiazepin-2-one |
| PubChem CID | 18940592 |
| Molecular Formula | C24H19F3N2O |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 1,3-dibenzyl-4-(trifluoromethyl)-3H-1,5-benzodiazepin-2-one |
| SMILES | O=C1C(Cc2ccccc2)C(C(F)(F)F)=Nc2ccccc2N1Cc1ccccc1 |
| InChI | InChI=1S/C24H19F3N2O/c25-24(26,27)22-19(15-17-9-3-1-4-10-17)23(30)29(16-18-11-5-2-6-12-18)21-14-8-7-13-20(21)28-22/h1-14,19H,15-16H2 |
| InChIKey | SNEOATQVYJISGY-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,3-dibenzyl-4-(trifluoromethyl)-3H-1,5-benzodiazepin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dibenzyl-4-(trifluoromethyl)-3H-1,5-benzodiazepin-2-one?
The IUPAC name of 1,3-dibenzyl-4-(trifluoromethyl)-3H-1,5-benzodiazepin-2-one (CID 18940592) is 1,3-dibenzyl-4-(trifluoromethyl)-3H-1,5-benzodiazepin-2-one.
What is the SMILES notation for 1,3-dibenzyl-4-(trifluoromethyl)-3H-1,5-benzodiazepin-2-one?
The canonical SMILES for 1,3-dibenzyl-4-(trifluoromethyl)-3H-1,5-benzodiazepin-2-one is O=C1C(Cc2ccccc2)C(C(F)(F)F)=Nc2ccccc2N1Cc1ccccc1.
What is the InChIKey of 1,3-dibenzyl-4-(trifluoromethyl)-3H-1,5-benzodiazepin-2-one?
The InChIKey is SNEOATQVYJISGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19F3N2O/c25-24(26,27)22-19(15-17-9-3-1-4-10-17)23(30)29(16-18-11-5-2-6-12-18)21-14-8-7-13-20(21)28-22/h1-14,19H,15-16H2.
What are the key properties of 1,3-dibenzyl-4-(trifluoromethyl)-3H-1,5-benzodiazepin-2-one?
1,3-dibenzyl-4-(trifluoromethyl)-3H-1,5-benzodiazepin-2-one has a molecular weight of 408.42 g/mol, XLogP of 5.73, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dibenzyl-4-(trifluoromethyl)-3H-1,5-benzodiazepin-2-one is sourced from PubChem (CID 18940592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).