C17H36N4 — CID 18940745
N,N'-bis(2-piperidin-2-ylethyl)propane-1,3-diamine (PubChem CID 18940745) has the molecular formula C17H36N4 and a molecular weight of 296.50 g/mol. Its IUPAC name is N,N'-bis(2-piperidin-2-ylethyl)propane-1,3-diamine.
| Compound Name | N,N'-bis(2-piperidin-2-ylethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 18940745 |
| Molecular Formula | C17H36N4 |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.29 |
| IUPAC Name | N,N'-bis(2-piperidin-2-ylethyl)propane-1,3-diamine |
| SMILES | C(CNCCC1CCCCN1)CNCCC1CCCCN1 |
| InChI | InChI=1S/C17H36N4/c1-3-12-20-16(6-1)8-14-18-10-5-11-19-15-9-17-7-2-4-13-21-17/h16-21H,1-15H2 |
| InChIKey | FAKWUDSCVICXTE-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|