About 9a,9b-dihydro-5aH-indeno[1,2-b][1]benzothiole
9a,9b-dihydro-5aH-indeno[1,2-b][1]benzothiole (PubChem CID 18940758) has the molecular formula C15H12S
and a molecular weight of 224.33 g/mol. Its IUPAC name is 9a,9b-dihydro-5aH-indeno[1,2-b][1]benzothiole.
Molecular Properties
| Compound Name | 9a,9b-dihydro-5aH-indeno[1,2-b][1]benzothiole |
| PubChem CID | 18940758 |
| Molecular Formula | C15H12S |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 9a,9b-dihydro-5aH-indeno[1,2-b][1]benzothiole |
| SMILES | C1=CC2SC3=c4ccccc4=CC3C2C=C1 |
| InChI | InChI=1S/C15H12S/c1-2-6-11-10(5-1)9-13-12-7-3-4-8-14(12)16-15(11)13/h1-9,12-14H |
| InChIKey | ODWBFZISWHBTBT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 9a,9b-dihydro-5aH-indeno[1,2-b][1]benzothiole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9a,9b-dihydro-5aH-indeno[1,2-b][1]benzothiole?
The IUPAC name of 9a,9b-dihydro-5aH-indeno[1,2-b][1]benzothiole (CID 18940758) is 9a,9b-dihydro-5aH-indeno[1,2-b][1]benzothiole.
What is the SMILES notation for 9a,9b-dihydro-5aH-indeno[1,2-b][1]benzothiole?
The canonical SMILES for 9a,9b-dihydro-5aH-indeno[1,2-b][1]benzothiole is C1=CC2SC3=c4ccccc4=CC3C2C=C1.
What is the InChIKey of 9a,9b-dihydro-5aH-indeno[1,2-b][1]benzothiole?
The InChIKey is ODWBFZISWHBTBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12S/c1-2-6-11-10(5-1)9-13-12-7-3-4-8-14(12)16-15(11)13/h1-9,12-14H.
What are the key properties of 9a,9b-dihydro-5aH-indeno[1,2-b][1]benzothiole?
9a,9b-dihydro-5aH-indeno[1,2-b][1]benzothiole has a molecular weight of 224.33 g/mol, XLogP of 2.06, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9a,9b-dihydro-5aH-indeno[1,2-b][1]benzothiole is sourced from PubChem (CID 18940758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).