About 7-methoxy-5aH-indeno[1,2-b][1]benzothiole
7-methoxy-5aH-indeno[1,2-b][1]benzothiole (PubChem CID 18940774) has the molecular formula C16H12OS
and a molecular weight of 252.34 g/mol. Its IUPAC name is 7-methoxy-5aH-indeno[1,2-b][1]benzothiole.
Molecular Properties
| Compound Name | 7-methoxy-5aH-indeno[1,2-b][1]benzothiole |
| PubChem CID | 18940774 |
| Molecular Formula | C16H12OS |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 7-methoxy-5aH-indeno[1,2-b][1]benzothiole |
| SMILES | COC1=CC2SC3=c4ccccc4=CC3=C2C=C1 |
| InChI | InChI=1S/C16H12OS/c1-17-11-6-7-13-14-8-10-4-2-3-5-12(10)16(14)18-15(13)9-11/h2-9,15H,1H3 |
| InChIKey | VAMTVBDBOHLVPM-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-methoxy-5aH-indeno[1,2-b][1]benzothiole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-5aH-indeno[1,2-b][1]benzothiole?
The IUPAC name of 7-methoxy-5aH-indeno[1,2-b][1]benzothiole (CID 18940774) is 7-methoxy-5aH-indeno[1,2-b][1]benzothiole.
What is the SMILES notation for 7-methoxy-5aH-indeno[1,2-b][1]benzothiole?
The canonical SMILES for 7-methoxy-5aH-indeno[1,2-b][1]benzothiole is COC1=CC2SC3=c4ccccc4=CC3=C2C=C1.
What is the InChIKey of 7-methoxy-5aH-indeno[1,2-b][1]benzothiole?
The InChIKey is VAMTVBDBOHLVPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12OS/c1-17-11-6-7-13-14-8-10-4-2-3-5-12(10)16(14)18-15(13)9-11/h2-9,15H,1H3.
What are the key properties of 7-methoxy-5aH-indeno[1,2-b][1]benzothiole?
7-methoxy-5aH-indeno[1,2-b][1]benzothiole has a molecular weight of 252.34 g/mol, XLogP of 2.10, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-5aH-indeno[1,2-b][1]benzothiole is sourced from PubChem (CID 18940774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).