C7H12N2 — CID 18940968
2,3,3a,4,7,7a-hexahydro-1H-benzimidazole (PubChem CID 18940968) has the molecular formula C7H12N2 and a molecular weight of 124.19 g/mol. Its IUPAC name is 2,3,3a,4,7,7a-hexahydro-1H-benzimidazole.
| Compound Name | 2,3,3a,4,7,7a-hexahydro-1H-benzimidazole |
|---|---|
| PubChem CID | 18940968 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | 2,3,3a,4,7,7a-hexahydro-1H-benzimidazole |
| SMILES | C1=CCC2NCNC2C1 |
| InChI | InChI=1S/C7H12N2/c1-2-4-7-6(3-1)8-5-9-7/h1-2,6-9H,3-5H2 |
| InChIKey | HBVJEDQHDMAZDT-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|