C13H15N3O4S2 — CID 18941108
2-(1-methylpyrrolidin-3-yl)-4-(1,3-thiazol-2-yl)-1,3-thiazole;oxalic acid (PubChem CID 18941108) has the molecular formula C13H15N3O4S2 and a molecular weight of 341.41 g/mol. Its IUPAC name is 2-(1-methylpyrrolidin-3-yl)-4-(1,3-thiazol-2-yl)-1,3-thiazole;oxalic acid.
| Compound Name | 2-(1-methylpyrrolidin-3-yl)-4-(1,3-thiazol-2-yl)-1,3-thiazole;oxalic acid |
|---|---|
| PubChem CID | 18941108 |
| Molecular Formula | C13H15N3O4S2 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 2-(1-methylpyrrolidin-3-yl)-4-(1,3-thiazol-2-yl)-1,3-thiazole;oxalic acid |
| SMILES | CN1CCC(c2nc(-c3nccs3)cs2)C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C11H13N3S2.C2H2O4/c1-14-4-2-8(6-14)10-13-9(7-16-10)11-12-3-5-15-11;3-1(4)2(5)6/h3,5,7-8H,2,4,6H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | ONVDSSZELXIOHS-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 103.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|