About cyclohexa-1,5-dien-1-ylurea
cyclohexa-1,5-dien-1-ylurea (PubChem CID 18941534) has the molecular formula C7H10N2O
and a molecular weight of 138.17 g/mol. Its IUPAC name is cyclohexa-1,5-dien-1-ylurea.
Molecular Properties
| Compound Name | cyclohexa-1,5-dien-1-ylurea |
| PubChem CID | 18941534 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | cyclohexa-1,5-dien-1-ylurea |
| SMILES | NC(=O)NC1=CCCC=C1 |
| InChI | InChI=1S/C7H10N2O/c8-7(10)9-6-4-2-1-3-5-6/h2,4-5H,1,3H2,(H3,8,9,10) |
| InChIKey | ZWWRRUUFOADIRP-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cyclohexa-1,5-dien-1-ylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexa-1,5-dien-1-ylurea?
The IUPAC name of cyclohexa-1,5-dien-1-ylurea (CID 18941534) is cyclohexa-1,5-dien-1-ylurea.
What is the SMILES notation for cyclohexa-1,5-dien-1-ylurea?
The canonical SMILES for cyclohexa-1,5-dien-1-ylurea is NC(=O)NC1=CCCC=C1.
What is the InChIKey of cyclohexa-1,5-dien-1-ylurea?
The InChIKey is ZWWRRUUFOADIRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O/c8-7(10)9-6-4-2-1-3-5-6/h2,4-5H,1,3H2,(H3,8,9,10).
What are the key properties of cyclohexa-1,5-dien-1-ylurea?
cyclohexa-1,5-dien-1-ylurea has a molecular weight of 138.17 g/mol, XLogP of 0.89, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexa-1,5-dien-1-ylurea is sourced from PubChem (CID 18941534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).