About 6-aminoquinoxaline-2,3-dione
6-aminoquinoxaline-2,3-dione (PubChem CID 18941541) has the molecular formula C8H5N3O2
and a molecular weight of 175.15 g/mol. Its IUPAC name is 6-aminoquinoxaline-2,3-dione.
Molecular Properties
| Compound Name | 6-aminoquinoxaline-2,3-dione |
| PubChem CID | 18941541 |
| Molecular Formula | C8H5N3O2 |
| Molecular Weight | 175.15 g/mol |
| Exact Mass | 175.04 |
| IUPAC Name | 6-aminoquinoxaline-2,3-dione |
| SMILES | Nc1ccc2c(c1)=NC(=O)C(=O)N=2 |
| InChI | InChI=1S/C8H5N3O2/c9-4-1-2-5-6(3-4)11-8(13)7(12)10-5/h1-3H,9H2 |
| InChIKey | TZCLXZMPJPMDDL-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 84.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.15 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 6-aminoquinoxaline-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-aminoquinoxaline-2,3-dione?
The IUPAC name of 6-aminoquinoxaline-2,3-dione (CID 18941541) is 6-aminoquinoxaline-2,3-dione.
What is the SMILES notation for 6-aminoquinoxaline-2,3-dione?
The canonical SMILES for 6-aminoquinoxaline-2,3-dione is Nc1ccc2c(c1)=NC(=O)C(=O)N=2.
What is the InChIKey of 6-aminoquinoxaline-2,3-dione?
The InChIKey is TZCLXZMPJPMDDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5N3O2/c9-4-1-2-5-6(3-4)11-8(13)7(12)10-5/h1-3H,9H2.
What are the key properties of 6-aminoquinoxaline-2,3-dione?
6-aminoquinoxaline-2,3-dione has a molecular weight of 175.15 g/mol, XLogP of -1.43, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-aminoquinoxaline-2,3-dione is sourced from PubChem (CID 18941541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).