C24H38O — CID 18941809
2-[(1E,3E,5E,7E)-9-butoxy-3,7-dimethylnona-1,3,5,7-tetraenyl]-1,3,3-trimethylcyclohexene (PubChem CID 18941809) has the molecular formula C24H38O and a molecular weight of 342.57 g/mol. Its IUPAC name is 2-[(1E,3E,5E,7E)-9-butoxy-3,7-dimethylnona-1,3,5,7-tetraenyl]-1,3,3-trimethylcyclohexene.
| Compound Name | 2-[(1E,3E,5E,7E)-9-butoxy-3,7-dimethylnona-1,3,5,7-tetraenyl]-1,3,3-trimethylcyclohexene |
|---|---|
| PubChem CID | 18941809 |
| Molecular Formula | C24H38O |
| Molecular Weight | 342.57 g/mol |
| Exact Mass | 342.29 |
| IUPAC Name | 2-[(1E,3E,5E,7E)-9-butoxy-3,7-dimethylnona-1,3,5,7-tetraenyl]-1,3,3-trimethylcyclohexene |
| SMILES | CCCCOC/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C24H38O/c1-7-8-18-25-19-16-21(3)12-9-11-20(2)14-15-23-22(4)13-10-17-24(23,5)6/h9,11-12,14-16H,7-8,10,13,17-19H2,1-6H3/b12-9+,15-14+,20-11+,21-16+ |
| InChIKey | CTDMILNVMLFWIL-MCCQDWKJSA-N |
| XLogP | 7.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.57 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|